CymitQuimica logo

CAS 24243-38-7

:

3-(5-methoxy-2,6-dimethyl-9-oxo-3,4,7,9-tetrahydro-2H-furo[3,4-h]chromen-2-yl)propanoic acid

Description:
3-(5-methoxy-2,6-dimethyl-9-oxo-3,4,7,9-tetrahydro-2H-furo[3,4-h]chromen-2-yl)propanoic acid, with the CAS number 24243-38-7, is a chemical compound characterized by its complex structure, which includes a furochromene moiety and a propanoic acid functional group. This compound features multiple functional groups, including a methoxy group and a ketone, contributing to its potential reactivity and biological activity. The presence of the tetrahydro structure suggests it may exhibit unique stereochemical properties, influencing its interactions in biological systems. The compound's molecular framework indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural similarity to bioactive natural products. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, making it essential to consider these factors in practical applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, warranting further investigation into its properties and potential uses.
Formula:C17H20O6
InChI:InChI=1/C17H20O6/c1-9-11-8-22-16(20)13(11)15-10(14(9)21-3)4-6-17(2,23-15)7-5-12(18)19/h4-8H2,1-3H3,(H,18,19)
SMILES:Cc1c2COC(=O)c2c2c(CCC(C)(CCC(=O)O)O2)c1OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.