CAS 24247-68-5: 1-oxa-3-azaspiro[4.5]decan-2-one

Description:1-Oxa-3-azaspiro[4.5]decan-2-one is a heterocyclic organic compound characterized by its unique spirocyclic structure, which includes both nitrogen and oxygen atoms in its ring system. The compound features a spiro arrangement, meaning it has two rings that share a single atom, contributing to its distinctive three-dimensional shape. The presence of the nitrogen atom in the azaspiro portion indicates potential basicity and reactivity, while the carbonyl group (ketone) at the second position suggests it may participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Additionally, its solubility and stability can vary based on the functional groups present and the overall molecular structure. As with many heterocycles, it may also display unique physical properties, such as melting and boiling points, which are influenced by its molecular interactions. Overall, 1-oxa-3-azaspiro[4.5]decan-2-one represents a fascinating class of compounds with potential applications in pharmaceuticals and materials science.

Formula:C₈H₁₃NO₂

InChI:InChI=1/C8H13NO2/c10-7-9-6-8(11-7)4-2-1-3-5-8/h1-6H2,(H,9,10)

Found 3 products.

Product data	Purity	Price range	Estimated delivery
1-oxa-3-azaspiro[4.5]decan-2-one REF: IN-DA01A518CAS: 24247-68-5	97%	To inquire	Mon 07 Apr 25
1-Oxa-3-azaspiro[4.5]decan-2-one REF: 10-F650917CAS: 24247-68-5	97%	To inquire	Tue 15 Apr 25
1-Oxa-3-azaspiro[4.5]decan-2-one REF: 3D-ZAA24768CAS: 24247-68-5	Min. 95%	To inquire	Mon 19 May 25