CAS 242472-11-3
:5-(4,5-Dihydro-4-methyl-5-thioxo-1H-1,2,4-triazol-3-yl)-1-(phenylmethyl)-2(1H)-pyridinone
Description:
5-(4,5-Dihydro-4-methyl-5-thioxo-1H-1,2,4-triazol-3-yl)-1-(phenylmethyl)-2(1H)-pyridinone, with the CAS number 242472-11-3, is a chemical compound characterized by its complex structure, which includes a pyridinone moiety and a triazole ring. This compound typically exhibits properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the thioxo group suggests possible reactivity and interactions with biological targets, while the phenylmethyl group may influence its lipophilicity and ability to cross biological membranes. The compound's unique structural features may contribute to its potential as a lead compound in drug development, particularly in areas related to antimicrobial or antifungal activity. As with many synthetic organic compounds, its stability, reactivity, and biological effects would depend on various factors, including pH, temperature, and the presence of other chemical species. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H14N4OS
InChI:InChI=1S/C15H14N4OS/c1-18-14(16-17-15(18)21)12-7-8-13(20)19(10-12)9-11-5-3-2-4-6-11/h2-8,10H,9H2,1H3,(H,17,21)
InChI key:InChIKey=VTQJFVBPUDKMHL-UHFFFAOYSA-N
SMILES:CN1C(=NNC1=S)C2=CN(CC3=CC=CC=C3)C(=O)C=C2
Synonyms:- 2(1H)-Pyridinone, 5-(4,5-dihydro-4-methyl-5-thioxo-1H-1,2,4-triazol-3-yl)-1-(phenylmethyl)-
- 5-(4,5-Dihydro-4-methyl-5-thioxo-1H-1,2,4-triazol-3-yl)-1-(phenylmethyl)-2(1H)-pyridinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.