CAS 24250-84-8
:4-bromo-L-phenylalanine
Description:
4-Bromo-L-phenylalanine is an amino acid derivative characterized by the presence of a bromine atom at the para position of the phenyl group attached to the alpha carbon of the L-phenylalanine structure. This compound is a non-proteinogenic amino acid, meaning it is not incorporated into proteins during translation but can be used in various biochemical applications. It exhibits properties typical of amino acids, such as the ability to form hydrogen bonds and participate in various chemical reactions due to its functional groups. The presence of the bromine atom can influence its reactivity and interactions, making it useful in synthetic organic chemistry and medicinal chemistry for developing pharmaceuticals. Additionally, 4-bromo-L-phenylalanine can serve as a building block in peptide synthesis and may have applications in studying protein structure and function. Its solubility and stability in different solvents can vary, which is important for its use in laboratory settings. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C9H11BrClNO2
InChI:InChI=1/C9H10BrNO2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,11H2,(H,12,13);1H/t8-;/m0./s1
SMILES:c1cc(ccc1C[C@@H](C(=O)O)N)Br.Cl
Synonyms:- H-p-Bromo-Phe-OH
- H-Phe(4-Br)-OH
- L-4-Bromophe
- (S)-4-Bromophenylalanine
- (2S)-2-amino-3-(4-bromophenyl)propanoic acid hydrochloride
- Fmoc-HomoArg-OH
- L-4-Bromophenylalanine
- Bromo-L-Phenylalanine,4-
- 4-Bromo-L-Phe-OH
- H-Phe(4-Br)-OH・HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
H-p-Bromo-Phe-OH
CAS:<p>Bachem ID: 4007011.</p>Formula:C9H10BrNO2Purity:> 99%Color and Shape:Beige PowderMolecular weight:244.094-Bromo-L-phenylalanine
CAS:Formula:C9H10BrNO2Purity:95%Color and Shape:SolidMolecular weight:244.0852Ref: IN-DA0033YJ
1g26.00€5g61.00€10g79.00€1kgTo inquire25g144.00€50g171.00€100g280.00€250g553.00€500gTo inquire250mg24.00€4-Bromo-L-phenylalanine
CAS:4-Bromo-L-phenylalanineFormula:C9H10BrNO2Purity:95%Color and Shape: white powderMolecular weight:244.0852g/mol4-Bromo-L-phenylalanine
CAS:<p>4-Bromo-L-phenylalanine is a potent inhibitor of the enzyme dehydrogenase. It is used in the synthesis of β-amino acids, which are precursors for peptides and proteins. 4-Bromo-L-phenylalanine has been shown to be an acceptor for the enzyme diacetate and it inhibits tryptic activity at low concentrations. 4-Bromo-L-phenylalanine has also been shown to be a potent antagonist of acid dehydrogenase from endophytic fungus. This compound has also been found to inhibit biosynthesis of proteins in thermodynamic studies. In validation studies, this compound was found to have low energy barriers.</p>Formula:C9H10BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:244.09 g/mol4-Bromo-L-phenylalanine
CAS:Controlled Product<p>Applications 4-BROMO-L-PHENYLALANINE (cas# 24250-84-8) is a useful research chemical.<br></p>Formula:C9H10BrNO2Color and Shape:NeatMolecular weight:244.09






