CymitQuimica logo

CAS 24255-25-2

:

Morpholine, 4-(2-pyridinyl)-

Description:
Morpholine, 4-(2-pyridinyl)-, also known by its CAS number 24255-25-2, is a heterocyclic organic compound that features a morpholine ring substituted with a pyridine group. This compound typically exhibits a colorless to pale yellow liquid form with a characteristic amine-like odor. It is soluble in water and organic solvents, which enhances its utility in various chemical applications. Morpholine derivatives are known for their role as intermediates in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. The presence of both morpholine and pyridine moieties contributes to its unique chemical reactivity, allowing it to participate in various nucleophilic and electrophilic reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted, as morpholine derivatives can pose health risks, including irritation to the skin and respiratory system. Proper handling and storage conditions are essential to mitigate any potential hazards associated with this compound.
Formula:C9H12N2O
InChI:InChI=1S/C9H12N2O/c1-2-4-10-9(3-1)11-5-7-12-8-6-11/h1-4H,5-8H2
InChI key:XHPVOSNOIWGRQQ-UHFFFAOYSA-N
SMILES:C1COCCN1C2=CC=CC=N2
Found 4 products.