CAS 24255-97-8
:2-Bromo-6-piperidinopyridine
Description:
2-Bromo-6-piperidinopyridine is a chemical compound characterized by its pyridine and piperidine functional groups. It features a bromine atom substituted at the 2-position of the pyridine ring, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the piperidine moiety enhances its basicity and solubility in various organic solvents. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its molecular structure allows for potential interactions with biological targets, making it of interest in drug discovery and development. Additionally, 2-Bromo-6-piperidinopyridine can serve as a versatile intermediate in the synthesis of more complex molecules, particularly in the development of pharmaceuticals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, this compound exemplifies the diverse chemistry of nitrogen-containing heterocycles.
Formula:C10H13BrN2
InChI:InChI=1/C10H13BrN2/c11-9-5-4-6-10(12-9)13-7-2-1-3-8-13/h4-6H,1-3,7-8H2
SMILES:C1CCN(CC1)c1cccc(Br)n1
Synonyms:- 2-Bromo-6-(piperidin-1-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Bromo-6-(piperidin-1-yl)pyridine
CAS:Formula:C10H13BrN2Color and Shape:LiquidMolecular weight:241.12762-Bromo-6-(piperidin-1-yl)pyridine
CAS:2-Bromo-6-(piperidin-1-yl)pyridine
Color and Shape:LiquidMolecular weight:241.13g/mol

