CAS 24260-31-9
:2-(2-methylpropyl)quinoline-4-carboxylate
Description:
2-(2-Methylpropyl)quinoline-4-carboxylate, with the CAS number 24260-31-9, is an organic compound that belongs to the class of quinoline derivatives. This substance features a quinoline core, which is a bicyclic structure composed of a benzene ring fused to a pyridine ring. The presence of a carboxylate group at the 4-position and a branched alkyl substituent (2-methylpropyl) at the 2-position contributes to its unique chemical properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structure, which can influence their solubility in organic solvents. Additionally, the presence of the carboxylate group can impart acidic characteristics, allowing for potential interactions with bases or metal ions. Such compounds may also exhibit biological activity, making them of interest in medicinal chemistry and drug development. Overall, the specific characteristics, including melting point, boiling point, and reactivity, would depend on the compound's molecular structure and the conditions under which it is studied.
Formula:C14H14NO2
InChI:InChI=1/C14H15NO2/c1-9(2)7-10-8-12(14(16)17)11-5-3-4-6-13(11)15-10/h3-6,8-9H,7H2,1-2H3,(H,16,17)/p-1
SMILES:CC(C)Cc1cc(c2ccccc2n1)C(=O)[O-]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
