CAS 24263-93-2
:5-Chloro-2-methyl-8-quinolinol
Description:
5-Chloro-2-methyl-8-quinolinol, with the CAS number 24263-93-2, is an organic compound that belongs to the class of quinolinols, which are derivatives of quinoline. This compound features a chloro group and a methyl group at specific positions on the quinoline ring, contributing to its unique chemical properties. It is typically characterized by its solid state at room temperature and exhibits a pale yellow to brownish color. The presence of the chloro substituent enhances its reactivity, making it useful in various chemical applications, including as an intermediate in the synthesis of pharmaceuticals and agrochemicals. Additionally, 5-Chloro-2-methyl-8-quinolinol has been studied for its potential antimicrobial and antifungal properties, which may be attributed to its ability to interact with biological systems. Its solubility in organic solvents and limited solubility in water are also notable characteristics, influencing its application in different chemical environments. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C10H8ClNO
InChI:InChI=1S/C10H8ClNO/c1-6-2-3-7-8(11)4-5-9(13)10(7)12-6/h2-5,13H,1H3
InChI key:InChIKey=OPQODOXIDNYMKA-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(Cl)=CC1)C=CC(C)=N2
Synonyms:- 5-Chloro-2-methyl-8-quinolinol
- 8-Quinolinol, 5-chloro-2-methyl-
- 5-Chloro-8-hydroxyquinaldine
- 5-Chloro-8-hydroxy-2-methyl-quinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
