CymitQuimica logo

CAS 24264-52-6

:

3-(3,5-dimethylphenoxy)butan-2-one

Description:
3-(3,5-Dimethylphenoxy)butan-2-one, with the CAS number 24264-52-6, is an organic compound characterized by its structure, which includes a butan-2-one backbone substituted with a 3-(3,5-dimethylphenoxy) group. This compound typically exhibits properties common to ketones, such as being a liquid at room temperature with a distinct odor. It is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic aromatic component. The presence of the dimethylphenoxy group suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, given its ability to participate in various chemical reactions. Additionally, the compound may exhibit specific reactivity patterns typical of ketones, such as nucleophilic addition and oxidation. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C12H16O2
InChI:InChI=1/C12H16O2/c1-8-5-9(2)7-12(6-8)14-11(4)10(3)13/h5-7,11H,1-4H3
SMILES:Cc1cc(C)cc(c1)OC(C)C(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.