CymitQuimica logo

CAS 24279-06-9

:

4,5,6,7-Tetrahydroindene

Description:
4,5,6,7-Tetrahydroindene is a bicyclic organic compound characterized by its unique structure, which consists of a fused cyclopentane and cyclohexene ring system. This compound is a colorless to pale yellow liquid at room temperature and has a distinctive aromatic odor. It is known for its relatively low boiling point and moderate solubility in organic solvents, making it useful in various chemical applications. The presence of double bonds in its structure contributes to its reactivity, allowing it to participate in various chemical reactions, such as hydrogenation and polymerization. 4,5,6,7-Tetrahydroindene is often utilized as a building block in organic synthesis and can serve as a precursor for more complex molecules. Additionally, it has applications in the production of resins and as a solvent in certain industrial processes. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 4,5,6,7-Tetrahydroindene is a versatile compound with significant relevance in organic chemistry and industrial applications.
Formula:C9H12
InChI:InChI=1/C9H12/c1-2-5-9-7-3-6-8(9)4-1/h3,6H,1-2,4-5,7H2
SMILES:C1CCC2=C(C1)C=CC2
Synonyms:
  • 4,5,6,7-Tetrahydro-1H-indene
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.