CAS 24280-74-8

4-azatricyclo[4.3.1.1~3,8~]undecane hydrochloride (1:1)

Description:

4-Azatricyclo[4.3.1.1^3,8]undecane hydrochloride is a bicyclic organic compound characterized by its unique tricyclic structure, which incorporates a nitrogen atom into the ring system. This compound features a nitrogen atom replacing one of the carbon atoms in the tricyclic framework, contributing to its classification as an azabicyclic compound. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The compound is typically studied for its potential biological activities, including its effects on the central nervous system, due to its structural similarity to other biologically active compounds. Its molecular structure allows for specific interactions with biological targets, which can be explored in drug development. As with many nitrogen-containing heterocycles, it may exhibit interesting properties such as basicity and reactivity, making it a subject of interest in synthetic organic chemistry and medicinal chemistry research.

Formula: C₁₀H₁₈ClN

InChI: InChI=1/C10H17N.ClH/c1-7-2-9-3-8(1)5-10(4-7)11-6-9;/h7-11H,1-6H2;1H

SMILES: C1C2CC3CC1CC(C2)NC3.Cl

4-Azatricyclo[4.3.1.1,3,8]undecane hydrochloride

CAS: 24280-74-8

4-Azatricyclo[4.3.1.1,3,8]undecane hydrochloride is a versatile compound that has various applications in different fields. It is commonly used in research as a catalyst and in the synthesis of organic compounds. This compound has been found to have potential antitumor properties in vitro, making it a valuable tool for cancer research. Additionally, 4-Azatricyclo[4.3.1.1,3,8]undecane hydrochloride can activate TGF-β1 and collagen synthesis, which is important for tissue repair and regeneration. Its unique structure allows it to form hydrogen bonds and act as a phase transfer catalyst in chemical reactions. Researchers also use this compound in studies related to halides, herbicides, and guanidine derivatives. With its broad range of applications and unique characteristics, 4-Azatricyclo[4.3.1.1,3,8]

Formula: C₁₀H₁₈ClN

Purity: Min. 95%

Molecular weight: 187.71 g/mol

Ref: 3D-ZAA28074