CAS 24292-29-3
:(1R,5R,6R)-5-hydroxy-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one
Description:
The chemical substance known as (1R,5R,6R)-5-hydroxy-3-(hydroxymethyl)-7-oxabicyclo[4.1.0]hept-3-en-2-one, with the CAS number 24292-29-3, is a bicyclic compound characterized by its unique structural features, including a bicyclo[4.1.0] framework and multiple functional groups. This compound contains hydroxyl (-OH) groups, which contribute to its potential reactivity and solubility in polar solvents. The presence of the oxabicyclic structure indicates that it may exhibit interesting stereochemical properties, influencing its biological activity and interactions. The compound's enone functionality suggests it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. Additionally, the stereochemistry denoted by the (1R,5R,6R) configuration implies specific spatial arrangements of its substituents, which can significantly affect its chemical behavior and potential applications in fields like medicinal chemistry or organic synthesis. Overall, this compound's unique structure and functional groups make it a subject of interest for further research and exploration in various chemical contexts.
Formula:C7H8O4
InChI:InChI=1/C7H8O4/c8-2-3-1-4(9)6-7(11-6)5(3)10/h1,4,6-9H,2H2/t4-,6-,7+/m1/s1
Synonyms:- 7-Oxabicyclo[4.1.0]hept-3-en-2-one, 5-hydroxy-3- (hydroxymethyl)-, (1R,5R,6R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phyllosinol
CAS:<p>Phyllosinol is an antifungal antibiotic.</p>Formula:C7H8O4Color and Shape:SolidMolecular weight:156.136
