CAS 24295-27-0
:methyl 3,5-dichloro-4-methoxybenzoate
Description:
Methyl 3,5-dichloro-4-methoxybenzoate, with the CAS number 24295-27-0, is an organic compound that belongs to the class of benzoates. It features a benzoic acid derivative structure, characterized by the presence of a methoxy group (-OCH3) and two chlorine atoms (Cl) at the 3 and 5 positions of the aromatic ring. This compound is typically a colorless to pale yellow solid or liquid, depending on its purity and form. It is known for its applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of chlorine atoms contributes to its reactivity and potential biological activity, while the methoxy group can influence its solubility and polarity. Methyl 3,5-dichloro-4-methoxybenzoate is generally handled with care due to its potential toxicity and environmental impact, necessitating appropriate safety measures during its use and disposal.
Formula:C9H8Cl2O3
InChI:InChI=1/C9H8Cl2O3/c1-13-8-6(10)3-5(4-7(8)11)9(12)14-2/h3-4H,1-2H3
SMILES:COc1c(cc(cc1Cl)C(=O)OC)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 3,5-dichloro-4-methoxybenzoate
CAS:Formula:C9H8Cl2O3Purity:95%Color and Shape:SolidMolecular weight:235.0640Methyl 3,5-dichloro-4-methoxybenzoate
CAS:<p>Methyl 3,5-dichloro-4-methoxybenzoate</p>Formula:C9H8Cl2O3Purity:≥95%Color and Shape:SolidMolecular weight:235.06g/molMethyl 3,5-dichloro-4-methoxybenzoate
CAS:<p>Methyl 3,5-dichloro-4-methoxybenzoate is a fine chemical and useful building block for research chemicals. It belongs to the class of speciality chemicals and can be used as a reagent in organic synthesis. Methyl 3,5-dichloro-4-methoxybenzoate is a versatile building block that has been reported in the synthesis of many complex compounds. This compound can also be used as an intermediate or scaffold for medicinal chemistry applications.</p>Formula:C9H8Cl2O3Purity:Min. 95%Molecular weight:235.06 g/mol
