CAS 24297-59-4
:1H-Indole-1-acetic acid
Description:
1H-Indole-1-acetic acid, with the CAS number 24297-59-4, is a naturally occurring compound that belongs to the class of indole derivatives. It is primarily recognized as a plant hormone, specifically an auxin, which plays a crucial role in regulating plant growth and development. This compound exhibits characteristics such as a relatively low molecular weight and a structure that includes an indole ring, which contributes to its biological activity. 1H-Indole-1-acetic acid is soluble in polar solvents like water and alcohol, making it accessible for various applications in plant physiology and biochemistry. Its role in promoting cell elongation, root formation, and apical dominance highlights its significance in agricultural practices. Additionally, this compound has been studied for its potential effects on cell signaling pathways and its interactions with other phytohormones. Overall, 1H-Indole-1-acetic acid is an important substance in both plant biology and agricultural science, with implications for enhancing crop yield and health.
Formula:C10H9NO2
InChI:InChI=1S/C10H9NO2/c12-10(13)7-11-6-5-8-3-1-2-4-9(8)11/h1-6H,7H2,(H,12,13)
InChI key:InChIKey=WQJFIWXYPKYBTO-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=2C(C=C1)=CC=CC2
Synonyms:- (Indole-1-yl)acetic acid
- 1H-Indole-1-acetic acid
- 1H-indol-1-ylacetic acid
- 2-(1H-Indol-1-yl)acetic acid
- 2-Indol-1-ylacetic acid
- Indole-1-acetic acid
- Indole-N-acetic acid
- N-Indolylacetic acid
- NSC 75866
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-Indoleacetic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C10H9NO2Purity:95%Molecular weight:175.182-(1H-Indol-1-yl)acetic acid
CAS:Formula:C10H9NO2Purity:95%Color and Shape:SolidMolecular weight:175.1840(1-Indolyl)acetic Acid
CAS:Formula:C10H9NO2Purity:>97.0%(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:175.19




