CAS 2430-01-5

2-bromo-N,N-diethylacetamide

Description:

2-Bromo-N,N-diethylacetamide is an organic compound characterized by its structure, which includes a bromine atom attached to the second carbon of a diethylacetamide backbone. This compound features a carbonyl group (C=O) and two ethyl groups (C2H5) attached to the nitrogen atom, contributing to its amide functionality. It is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The presence of the bromine atom enhances its reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and as a potential intermediate in organic synthesis. The compound is of interest in medicinal chemistry and may exhibit biological activity, although specific pharmacological properties would depend on further studies. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns. Proper storage and handling protocols are essential to mitigate risks associated with exposure.

Formula: C₆H₁₂BrNO

InChI: InChI=1/C6H12BrNO/c1-3-8(4-2)6(9)5-7/h3-5H2,1-2H3

SMILES: CCN(CC)C(=O)CBr

2-Bromo-N,N-diethylacetamide

CAS: 2430-01-5

2-Bromo-N,N-diethylacetamide is a chemical compound that is used as an amide. It has been shown to have anti-inflammatory properties and can be used for the treatment of inflammatory lesions. This drug also has been shown to inhibit the production of 3-bromopropylamine hydrobromide in laboratory animals. 2-Bromo-N,N-diethylacetamide binds to cellular proteins such as mt2 receptors and can be used for the treatment of nervous system diseases such as depression. The titration calorimetry shows that 2-Bromo-N,N-diethylacetamide is a good candidate for use in biomolecular applications due to its low toxicity and high thermal stability.

Formula: C₆H₁₂BrNO

Purity: Min. 95%

Color and Shape: Liquid

Molecular weight: 194.07 g/mol

Ref: 3D-FB127679

2-Bromo-N,N-diethylacetamide

CAS: 2430-01-5

Formula: C₆H₁₂BrNO

Purity: 95.0%

Color and Shape: Clear

Molecular weight: 194.072

Ref: 10-F044522