CAS 2430-94-6
:cis-5-Dodecenoic acid
Description:
Cis-5-Dodecenoic acid is a long-chain unsaturated fatty acid characterized by its cis configuration at the fifth carbon position of the dodecenoic acid chain. This compound features a carbon chain consisting of twelve carbon atoms, with a double bond that introduces a degree of unsaturation, influencing its physical and chemical properties. Typically, cis-5-Dodecenoic acid is a colorless to pale yellow liquid at room temperature, exhibiting a characteristic fatty odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of the double bond contributes to its reactivity, making it susceptible to oxidation and polymerization under certain conditions. This fatty acid is of interest in various applications, including the synthesis of surfactants, lubricants, and as a potential precursor in the production of biofuels and bioplastics. Additionally, its structural features may impart specific biological activities, making it a subject of research in fields such as biochemistry and nutrition.
Formula:C12H22O2
InChI:InChI=1S/C12H22O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h7-8H,2-6,9-11H2,1H3,(H,13,14)/b8-7-
InChI key:InChIKey=IJBFSOLHRKELLR-FPLPWBNLSA-N
SMILES:C(/C=C\CCCCCC)CCC(O)=O
Synonyms:- 5-Dodecenoic acid, (5Z)-
- cis-5-Dodecenoic acid
- (Z)-Dodec-5-enoic acid
- (5Z)-5-Dodecenoic acid
- 5-Dodecenoic acid, (Z)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cis-5-Dodecenoic Acid
CAS:Cis-5-Dodecenoic Acid is a monounsaturated fatty acid that has a C12 chain as a backbone and a cis double bond at the C5 position.Formula:C12H22O2Purity:98% - 99.37%Color and Shape:SolidMolecular weight:198.3(5Z)-5-Dodecenoic Acid
CAS:Controlled ProductStability Light Sensitive
Applications (5Z)-5-Dodecenoic acid is a fatty acid and a component of the essential oils of certain plants, such as Paeonia lactiflora Pall., and is used as biofuel.
References Liu, P.; et al.: Industrial Crops and Products, 107, 260 (2017); Xu, L.; et al.: Renewable Energy, 130, 910 (2019).Formula:C12H22O2Color and Shape:NeatMolecular weight:198.30




