CAS 2431-50-7
:2,3,4-Trichloro-1-butene
Description:
2,3,4-Trichloro-1-butene is an organic compound characterized by the presence of three chlorine atoms and a double bond within a four-carbon chain. Its molecular formula is C4H5Cl3, indicating a relatively low molecular weight. This compound is a colorless to pale yellow liquid at room temperature and is known for its distinctive chemical reactivity due to the presence of the double bond and multiple chlorine substituents. It is classified as a chlorinated alkene, which can participate in various chemical reactions, including nucleophilic substitutions and additions. 2,3,4-Trichloro-1-butene is primarily used in industrial applications, including as an intermediate in the synthesis of other chemical compounds. Its handling requires caution due to potential toxicity and environmental concerns associated with chlorinated compounds. Additionally, it may exhibit properties such as volatility and solubility in organic solvents, making it relevant in both chemical manufacturing and research contexts. Proper safety measures should be observed when working with this substance to mitigate any health risks.
Formula:C4H5Cl3
InChI:InChI=1/C4H5Cl3/c1-3(6)4(7)2-5/h4H,1-2H2
InChI key:InChIKey=WZUZDBPJFHQVJC-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)(CCl)Cl
Synonyms:- 2,3,4-Trichloro-1-butene
- 1-Butene, 2,3,4-trichloro-
- 2,3,4-Trichlorobutene-1
- Brn 1745897
- Hsdb 5878
- Butene, 2,3,4-trichloro-, 1-
- 3-01-00-00725 (Beilstein Handbook Reference)
- 2,3,4-Trichlorobut-1-ene
- 2,3,4-Trichlorbut-1-en
- Trichlorobutene
- 2,3,4-Trichlorobuta-1-ene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.