CAS 24310-15-4: 2-(naphthalen-1-yloxy)acetohydrazide

Description:2-(Naphthalen-1-yloxy)acetohydrazide is an organic compound characterized by its hydrazide functional group and a naphthalene moiety. It features a naphthalen-1-yloxy group attached to an acetohydrazide structure, which contributes to its potential biological activity. The compound typically appears as a solid and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the hydrazide functional group can also indicate reactivity, particularly in forming hydrazones or undergoing oxidation reactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-(naphthalen-1-yloxy)acetohydrazide represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula:C₁₂H₁₂N₂O₂

InChI:InChI=1/C12H12N2O2/c13-14-12(15)8-16-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H,8,13H2,(H,14,15)

Synonyms:
2-(1-Naphthyloxy)acetohydrazide
Acetic acid, 2-(1-naphthalenyloxy)-, hydrazide

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-(Naphthalen-1-yloxy)acetohydrazide REF: IN-DA007NTACAS: 24310-15-4	98%	44.00 €~531.00 €	Mon 14 Apr 25
2-(Naphthoxy)acetic acid hydrazide REF: 54-OR9192CAS: 24310-15-4	95%	32.00 €~52.00 €	Tue 15 Apr 25
1-(Naphthoxy)acetic acid hydrazide REF: 10-F011198CAS: 24310-15-4	98.0%	23.00 €~326.00 €	Tue 15 Apr 25
2-(1-Naphthyloxy)acetohydrazide REF: 3D-FN114187CAS: 24310-15-4	Min. 95%	142.00 €~906.00 €	Mon 19 May 25