CAS 24310-15-4

2-(naphthalen-1-yloxy)acetohydrazide

Description:

2-(Naphthalen-1-yloxy)acetohydrazide is an organic compound characterized by its hydrazide functional group and a naphthalene moiety. It features a naphthalen-1-yloxy group attached to an acetohydrazide structure, which contributes to its potential biological activity. The compound typically appears as a solid and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The presence of the hydrazide functional group can also indicate reactivity, particularly in forming hydrazones or undergoing oxidation reactions. Additionally, the compound may exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 2-(naphthalen-1-yloxy)acetohydrazide represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.

Formula: C₁₂H₁₂N₂O₂

InChI: InChI=1/C12H12N2O2/c13-14-12(15)8-16-11-7-3-5-9-4-1-2-6-10(9)11/h1-7H,8,13H2,(H,14,15)

SMILES: c1ccc2c(c1)cccc2OCC(=NN)O

Synonyms:

• 2-(1-Naphthyloxy)acetohydrazide
• Acetic acid, 2-(1-naphthalenyloxy)-, hydrazide

2-(Naphthalen-1-yloxy)acetohydrazide

CAS: 24310-15-4

Formula: C₁₂H₁₂N₂O₂

Purity: 98%

Molecular weight: 216.2359

Ref: IN-DA007NTA

2-(Naphthoxy)acetic acid hydrazide

CAS: 24310-15-4

2-(Naphthoxy)acetic acid hydrazide

Formula: C₁₂H₁₂N₂O₂

Purity: 95%

Color and Shape: white to off-white solid

Molecular weight: 216.24g/mol

Ref: 54-OR9192

1-(Naphthoxy)acetic acid hydrazide

CAS: 24310-15-4

Formula: C₁₂H₁₂N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.24

Ref: 10-F011198

2-(1-Naphthyloxy)acetohydrazide

CAS: 24310-15-4

2-(1-Naphthyloxy)acetohydrazide is a lipoxygenase inhibitor that has been shown to inhibit the activity of dihdroxygenases in the nanomolar range. These enzymes catalyze the initial step in lipid metabolism and are involved in the synthesis of prostaglandins and leukotrienes, which play a role in inflammatory diseases. 2-(1-Naphthyloxy)acetohydrazide is a potent inhibitor of lipoxygenases, with an IC50 value of 0.5 μM, and has been shown to be effective at inhibiting the release of arachidonic acid from cell membranes. This drug also inhibits cyclooxygenase-2 (COX-2), which is involved in inflammation, pain, fever and other conditions. The inhibition of COX-2 by 2-(1-naphthyloxy)acetohydrazide may be due to its ability to bind competitively with

Formula: C₁₂H₁₂N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 216.24 g/mol

Ref: 3D-FN114187