CAS 243137-97-5
:4-(3-bromobenzoyl)benzonitrile
Description:
4-(3-Bromobenzoyl)benzonitrile, identified by its CAS number 243137-97-5, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a bromobenzoyl group and a nitrile group. This compound typically exhibits a solid state at room temperature and is likely to be sparingly soluble in water due to its hydrophobic aromatic nature, but may dissolve in organic solvents. The presence of the bromine atom introduces notable electronegativity, influencing the compound's reactivity and potential applications in organic synthesis or as an intermediate in pharmaceuticals. The nitrile functional group contributes to its polarity and can participate in various chemical reactions, such as nucleophilic additions. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, which can be utilized for structural elucidation. Overall, 4-(3-bromobenzoyl)benzonitrile is a valuable compound in synthetic organic chemistry, particularly in the development of more complex molecular architectures.
Formula:C14H8BrNO
InChI:InChI=1/C14H8BrNO/c15-13-3-1-2-12(8-13)14(17)11-6-4-10(9-16)5-7-11/h1-8H
SMILES:c1cc(cc(c1)Br)C(=O)c1ccc(cc1)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.