CAS 243139-71-1: 1-(Chloromethyl)-2,4,5-trifluorobenzene
Description:1-(Chloromethyl)-2,4,5-trifluorobenzene, with the CAS number 243139-71-1, is an organic compound characterized by a benzene ring substituted with three fluorine atoms and a chloromethyl group. The presence of the trifluoromethyl groups significantly influences its chemical properties, imparting high electronegativity and altering its reactivity compared to non-fluorinated analogs. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It exhibits moderate polarity due to the electronegative fluorine atoms, which can affect its solubility in various solvents. The chloromethyl group makes it a potential electrophile, allowing it to participate in nucleophilic substitution reactions. Additionally, the trifluoromethyl groups can enhance the compound's stability and resistance to oxidation. Due to its unique structure, 1-(Chloromethyl)-2,4,5-trifluorobenzene may find applications in pharmaceuticals, agrochemicals, and materials science, particularly in the synthesis of more complex fluorinated compounds. Safety precautions should be taken when handling this substance, as it may pose health risks.
Formula:C7H4ClF3
InChI:InChI=1S/C7H4ClF3/c8-3-4-1-6(10)7(11)2-5(4)9/h1-2H,3H2
InChI key:InChIKey=JMXPOOVDUVHJRO-UHFFFAOYSA-N
SMILES:FC=1C=C(F)C(=CC1F)CCl
- Synonyms:
- (2,3,5,6-Tetrafluoro-4-Methoxyphenyl)Methanol
- 1-(Chloromethyl)-2,4,5-trifluorobenzene
- 2,4,5-Trifluorobenzyl Choride
- Benzene, 1-(chloromethyl)-2,4,5-trifluoro-
- G1R Bf Df Ef
- 2,4,5-Trifluorobenzyl chloride
