CymitQuimica logo

CAS 243145-83-7

:

4-Fluorobenzylboronic acid pinacol ester

Description:
4-Fluorobenzylboronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid functional group and a fluorobenzyl moiety. It typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and ethanol. The compound is notable for its reactivity, particularly in Suzuki-Miyaura cross-coupling reactions, where it serves as a versatile building block in organic synthesis, especially in the formation of biaryl compounds. The presence of the fluorine atom can influence the electronic properties of the molecule, enhancing its reactivity and selectivity in various chemical transformations. Additionally, the pinacol ester group provides stability to the boronic acid functionality, making it easier to handle and store. This compound is of interest in medicinal chemistry and materials science due to its potential applications in drug development and the synthesis of functionalized polymers. As with many organoboron compounds, proper handling and storage are essential due to their sensitivity to moisture and air.
Formula:C13H18BFO2
InChI:InChI=1S/C13H18BFO2/c1-12(2)13(3,4)17-14(16-12)9-10-5-7-11(15)8-6-10/h5-8H,9H2,1-4H3
InChI key:RLTRQJNDILQGNA-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)F
Synonyms:
  • 2-(4-Fluorobenzyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Found 5 products.