CAS 2432-11-3
:2,6-Diphenylphenol
Description:
2,6-Diphenylphenol, with the CAS number 2432-11-3, is an organic compound characterized by its structure, which features two phenyl groups attached to a phenolic core. This compound is typically a white to light yellow crystalline solid and is known for its antioxidant properties, making it useful in various applications, including as a stabilizer in plastics and rubber. It exhibits moderate solubility in organic solvents but is generally insoluble in water. The compound has a melting point that varies depending on purity and specific conditions. 2,6-Diphenylphenol can undergo typical reactions of phenolic compounds, such as oxidation and substitution, and it may also exhibit weak acidity due to the presence of the hydroxyl group. Its applications extend to the fields of materials science and polymer chemistry, where it serves to enhance the thermal stability and longevity of products. Safety data indicates that, like many phenolic compounds, it should be handled with care due to potential irritant properties.
Formula:C18H14O
InChI:InChI=1S/C18H14O/c19-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h1-13,19H
InChI key:InChIKey=ATGFTMUSEPZNJD-UHFFFAOYSA-N
SMILES:OC1=C(C=CC=C1C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- 1,1':3',1''-Terphenyl-2'-Ol
- 2,6-Diphenyl phenol
- 2,6-Diphenylphenol
- 2′-Hydroxy-m-terphenyl
- Phenol, 2,6-diphenyl-
- [1,1′:3′,1′′-Terphenyl]-2′-ol
- m-Terphenyl-2'-ol
- [m-Terphenyl]-2′-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,6-Diphenylphenol
CAS:Formula:C18H14OPurity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:246.312,6-Diphenylphenol
CAS:2,6-Diphenylphenolis a high purity biochemical reagent that can be used in research related to life sciences.Formula:C18H14OPurity:99.87%Color and Shape:SolidMolecular weight:246.3[1,1':3',1''-Terphenyl]-2'-ol
CAS:Purity:95.0%Color and Shape:SolidMolecular weight:246.30900573730472,6-Diphenylphenol
CAS:2,6-Diphenylphenol is a phenolic compound that can be synthesized by the Friedel-Crafts reaction or by the Suzuki coupling reaction. It has been shown to have light emission properties in an electrochemical impedance spectroscopy model system. 2,6-Diphenylphenol is an electron donor and a cross-linking agent that is used to form strong covalent bonds between two molecules. Protonation of 2,6-diphenylphenol results in intramolecular hydrogen bonding and intermolecular hydrogen bonding. 2,6-Diphenylphenol also forms hydrogen bonds with water vapor and has been shown to have proton transfer properties.Formula:C18H14OPurity:Min. 95%Color and Shape:White PowderMolecular weight:246.31 g/mol







