
CAS 24320-06-7
:Org 2058
Description:
Org 2058, identified by its CAS number 24320-06-7, is a chemical compound that belongs to a specific class of substances often used in various industrial applications. While detailed characteristics such as its molecular structure, physical properties, and specific uses may vary, compounds like Org 2058 typically exhibit properties such as solubility in organic solvents, stability under standard conditions, and potential reactivity with other chemical agents. These compounds may serve roles in fields such as pharmaceuticals, agrochemicals, or materials science, depending on their functional groups and molecular interactions. Safety data sheets (SDS) and material safety information are essential for understanding the handling, storage, and potential hazards associated with Org 2058. For precise applications and characteristics, consulting specialized literature or databases is recommended, as they provide comprehensive insights into the compound's behavior and safety profile in various contexts.
Formula:C22H32O3
InChI:InChI=1S/C22H32O3/c1-3-13-11-19-18-6-4-14-10-15(24)5-7-16(14)17(18)8-9-22(19,2)21(13)20(25)12-23/h10,13,16-19,21,23H,3-9,11-12H2,1-2H3/t13-,16+,17-,18-,19+,21-,22+/m1/s1
InChI key:InChIKey=IJLXLZGJDSJGIQ-BILPMHSYSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](CC1)([C@@]4(C(CC3)=CC(=O)CC4)[H])[H])[H])(C[C@@H](CC)[C@@H]2C(CO)=O)[H]
Synonyms:- 19-Norpregn-4-ene-3,20-dione, 16α-ethyl-21-hydroxy-
- 19-Norpregn-4-ene-3,20-dione, 16-ethyl-21-hydroxy-, (16α)-
- 16α-Ethyl-21-hydroxy-19-nor-4-pregnene-3,20-dione
- (16α)-16-Ethyl-21-hydroxy-19-norpregn-4-ene-3,20-dione
- Org 2058
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Org 2058
CAS:Org 2058 is a synthetic progestin.Formula:C22H32O3Color and Shape:SolidMolecular weight:344.49
