CAS 2433-97-8
:Methyl tricosanoate
Description:
Methyl tricosanoate, with the CAS number 2433-97-8, is an ester derived from tricosanoic acid and methanol. It is a long-chain fatty acid methyl ester, characterized by its hydrophobic nature and relatively high molecular weight. This compound typically appears as a colorless to pale yellow liquid with a faint odor. Methyl tricosanoate is insoluble in water but soluble in organic solvents such as ethanol and chloroform. Its structure consists of a long hydrocarbon chain, which contributes to its properties as a surfactant and emulsifier in various applications. Additionally, it is used in the production of biodiesel and as a potential feedstock for the synthesis of other chemical compounds. The compound exhibits low volatility and stability under normal conditions, making it suitable for various industrial applications. Its fatty acid composition also suggests potential nutritional and health-related benefits, although specific biological activities would require further investigation. Overall, methyl tricosanoate is a versatile compound with applications in both industrial and research settings.
Formula:C24H48O2
InChI:InChI=1S/C24H48O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24(25)26-2/h3-23H2,1-2H3
InChI key:InChIKey=VORKGRIRMPBCCZ-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)CCCCC(OC)=O
Synonyms:- Methyl tricosanoate
- Tricosanoic acid, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
Methyl Tricosanoate (Tricosanoic acid, methyl ester)
CAS:Saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides etc, nesoiFormula:C24H48O2Color and Shape:White PowderMolecular weight:368.64Ref: IN-DA006WA2
1g120.00€5g535.00€10gTo inquire50gTo inquire100gTo inquire250gTo inquire100mg50.00€250mg64.00€Methyl tricosanoate
CAS:<p>Methyl tricosanoate</p>Formula:C24H48O2Purity:99%Color and Shape: white solidMolecular weight:368.64g/molMethyl tricosanoate
CAS:Formula:CH3(CH2)21COOCH3Purity:(GC) ≥ 99.0%Color and Shape:White crystalline powderMolecular weight:368.64Methyl tricosanoate
CAS:<p>Methyl Tricosanoate is a long-chain fatty acid compound present in various antimicrobial and antibacterial agents.</p>Formula:C24H48O2Purity:98%Color and Shape:White PowderMolecular weight:368.64Methyl Tricosanoate
CAS:<p>Applications Methyl Tricosanoate is a long chain fatty acid compound present in various antimicrobial and antibacterial agent extracts from florae.<br>References Badoni, R. et al.: J. Sci. Res., 2, 397 (2010); Hayee-Memon, A. et al.: Int. J. Phyc. Phycochem., 6, 17 (2010);<br></p>Formula:C24H48O2Color and Shape:White To Off-WhiteMolecular weight:368.64Methyl tricosanoate
CAS:<p>Methyl tricosanoate is a subcritical water extraction product. It is an acid with a melting point of -3°C that can be hydrolyzed to methyl eicosanoate and methyl myristate. The primary use of this compound is in the production of biodiesel, which is used as an alternative fuel for vehicles. Methyl tricosanoate has been found to inhibit the growth of bacteria such as Escherichia coli, Salmonella typhimurium, and Staphylococcus aureus in human serum. This compound also inhibits the growth of Candida albicans, which causes infection in humans. Methyl tricosanoate has been shown to have antiviral and antibacterial properties.</p>Formula:C24H48O2Purity:Min. 95%Molecular weight:368.64 g/mol











