CAS 24332-98-7
:methyl-6-deoxy-B-L-galactopyranoside
Description:
Methyl-6-deoxy-β-L-galactopyranoside is a carbohydrate derivative characterized by its structural features as a methyl glycoside of a deoxy sugar. It is derived from galactose, where the hydroxyl group at the 6-position is replaced by a methyl group, resulting in a 6-deoxy form. This compound typically appears as a white to off-white crystalline solid and is soluble in water and organic solvents, reflecting its polar nature due to the presence of hydroxyl groups. It is often used in biochemical research and synthesis, particularly in the study of glycosylation reactions and carbohydrate chemistry. The compound may exhibit various biological activities, including potential roles in cell signaling and recognition processes. Its CAS number, 24332-98-7, allows for precise identification in chemical databases and literature. As with many sugar derivatives, it may participate in various chemical reactions, including hydrolysis and oxidation, making it a versatile compound in organic synthesis and medicinal chemistry.
Formula:C7H14O5
InChI:InChI=1/C7H14O5/c1-3-4(8)5(9)6(10)7(11-2)12-3/h3-10H,1-2H3/t3-,4+,5+,6-,7-/m0/s1
Synonyms:- Methyl--L-fucopyranoside
- methyl 6-deoxy-beta-L-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Methyl b-L-fucopyranoside
CAS:Methyl b-L-fucopyranoside is a glycosylating agent that is used to modify saccharides and oligosaccharides. It can be used for the synthesis of complex carbohydrates, such as polysaccharides and glycoconjugates. Methyl b-L-fucopyranoside is also useful for the synthesis of glycosylated proteins, which are proteins with sugar chains attached to them. The product is a white solid that is soluble in water.Formula:C7H14O5Purity:Min. 95%Color and Shape:White PowderMolecular weight:178.18 g/mol
