CymitQuimica logo

CAS 24332-99-8

:

β-L-Galactopyranoside, 4-nitrophenyl 6-deoxy-, 2,3,4-triacetate

Description:
β-L-Galactopyranoside, 4-nitrophenyl 6-deoxy-, 2,3,4-triacetate, with the CAS number 24332-99-8, is a synthetic glycoside that serves as a substrate in biochemical assays, particularly for the detection of galactosidase activity. This compound features a β-galactopyranoside structure, which is a cyclic form of galactose, modified with a 4-nitrophenyl group that acts as a chromogenic indicator. The presence of the 6-deoxy and triacetate groups enhances its stability and solubility in organic solvents. Upon enzymatic hydrolysis by galactosidases, the compound releases 4-nitrophenol, which can be quantitatively measured due to its distinct yellow color, making it useful in various laboratory applications, including enzyme kinetics and molecular biology studies. The compound is typically handled with standard laboratory safety precautions, as it may pose health risks if ingested or inhaled. Its applications extend to research in carbohydrate chemistry and enzymology, contributing to our understanding of glycosidic bond hydrolysis.
Formula:C18H21NO10
InChI:InChI=1S/C18H21NO10/c1-9-15(26-10(2)20)16(27-11(3)21)17(28-12(4)22)18(25-9)29-14-7-5-13(6-8-14)19(23)24/h5-9,15-18H,1-4H3/t9-,15+,16+,17-,18+/m0/s1
InChI key:InChIKey=JQVBTXUZEDHPID-LXNKJQKCSA-N
SMILES:O(C(C)=O)[C@H]1[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H](C)O[C@@H]1OC2=CC=C(N(=O)=O)C=C2
Synonyms:
  • β-L-Galactopyranoside, 4-nitrophenyl 6-deoxy-, 2,3,4-triacetate
  • Galactopyranoside, p-nitrophenyl 6-deoxy-, 2,3,4-triacetate, β-L-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.