CAS 24345-74-2

1-azido-2-(2-azidoethoxy)ethane

Description:

1-Azido-2-(2-azidoethoxy)ethane is a chemical compound characterized by the presence of azide functional groups, which are known for their reactivity and potential applications in organic synthesis and materials science. The compound features a two-carbon ethane backbone with azido groups (-N3) attached, contributing to its unique properties. The presence of the ethoxy group enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound is typically handled with caution due to the inherent instability and explosive nature of azides, particularly under heat or shock. Its reactivity allows it to participate in click chemistry, facilitating the formation of diverse chemical structures. Additionally, 1-azido-2-(2-azidoethoxy)ethane may be utilized in the development of pharmaceuticals, polymers, and other advanced materials. As with many azide-containing compounds, proper safety protocols should be followed during its synthesis and handling to mitigate risks associated with its explosive potential.

Formula: C₄H₈N₆O

InChI: InChI=1/C4H8N6O/c5-9-7-1-3-11-4-2-8-10-6/h1-4H2

SMILES: C(COCCN=[N+]=[NH-])N=[N+]=[NH-]

Azido-PEG1-azide

CAS: 24345-74-2

Azido-PEG1-azide

Purity: ≥98%

Molecular weight: 156.15g/mol

Ref: 54-BUP16431

Azido-PEG1-azide

CAS: 24345-74-2

Azido-PEG1-azide is a PEG-based PROTAC linker that can be used in PROTAC synthesis.

Formula: C₄H₈N₆O

Purity: ≥98%

Color and Shape: Solid

Molecular weight: 156.15

Ref: TM-T17476

1,5-Diazido-3-oxapentane

Controlled Product

CAS: 24345-74-2

Formula: C₄H₈N₆O

Color and Shape: Neat

Molecular weight: 156.15

Ref: TR-D417280

1,5-Diazido-3-oxapentane

CAS: 24345-74-2

Azido-PEG1-Azide, or bis-PEG1-azide is a PEG polymer categorised as homobifunctional PEG (X-PEG X). Used as a linker,bis-PEG1-azide is used to attached PEG to proteins, peptides, oligonucleotides, nanoparticles and small molecules via pegylation, a bioconjugation technique.

Formula: C₄H₈N₆O

Purity: Min. 95%

Color and Shape: Colorless Powder

Molecular weight: 156.15 g/mol

Ref: 3D-FD21513

Azido-PEG1-azide

CAS: 24345-74-2

Purity: 98%

Molecular weight: 156.149

Ref: 10-F987213

Ethane,1,1'-oxybis[2-azido-

CAS: 24345-74-2

Formula: C₄H₈N₆O

Purity: 98%

Color and Shape: Liquid

Molecular weight: 156.1459

Ref: IN-DA007NRZ