CAS 243459-91-8
:5-Fluoro-2-(trifluoromethyl)phenol
Description:
5-Fluoro-2-(trifluoromethyl)phenol is an organic compound characterized by the presence of a fluorine atom and a trifluoromethyl group attached to a phenolic structure. Its molecular formula is C8H5F4O, indicating that it contains eight carbon atoms, five hydrogen atoms, four fluorine atoms, and one oxygen atom. This compound typically appears as a white to off-white solid and is known for its potential applications in pharmaceuticals and agrochemicals due to its unique electronic properties imparted by the fluorine substituents. The presence of the trifluoromethyl group enhances lipophilicity, which can influence the compound's biological activity and solubility. Additionally, 5-Fluoro-2-(trifluoromethyl)phenol may exhibit interesting reactivity patterns, making it a valuable intermediate in organic synthesis. Safety data should be consulted for handling and storage, as fluorinated compounds can pose specific health and environmental risks. Overall, this compound is of interest in various fields, including medicinal chemistry and materials science.
Formula:C7H4F4O
InChI:InChI=1/C7H4F4O/c8-4-1-2-5(6(12)3-4)7(9,10)11/h1-3,12H
SMILES:c1cc(c(cc1F)O)C(F)(F)F
Synonyms:- alpha,alpha,alpha,5-Tetrafluoro-o-cresol
- Phenol, 5-fluoro-2-(trifluoromethyl)-
- Qr Cf Fxfff [Wln]
- 5-Fluoro-2-Trifluoromethyl-Phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Fluoro-2-(trifluoromethyl)phenol, 97%
CAS:<p>As raw material in organic synthesis. Utilized in the dye industry. As pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesa</p>Formula:C7H4F4OPurity:97%Color and Shape:Crystals or powder or crystalline powder, WhiteMolecular weight:180.105-Fluoro-2-(trifluoromethyl)phenol
CAS:Formula:C7H4F4OPurity:98%Color and Shape:SolidMolecular weight:180.09974-Fluoro-2-hydroxybenzotrifluoride
CAS:4-Fluoro-2-hydroxybenzotrifluorideFormula:C7H4F4OPurity:98%Color and Shape: almost white crystalline solidMolecular weight:180.10g/mol5-Fluoro-2-(trifluoromethyl)phenol
CAS:Formula:C7H4F4OPurity:97%Color and Shape:Solid, White to cream powderMolecular weight:180.102



