CAS 24346-56-3

ethyl 2-benzoylbutanoate

Description:

Ethyl 2-benzoylbutanoate, with the CAS number 24346-56-3, is an organic compound belonging to the class of esters. It is characterized by its structure, which includes an ethyl group, a benzoyl moiety, and a butanoate backbone. This compound typically appears as a colorless to pale yellow liquid with a pleasant, fruity aroma, making it useful in flavoring and fragrance applications. Ethyl 2-benzoylbutanoate is known for its moderate solubility in organic solvents and limited solubility in water, which is common for many esters. It exhibits stability under normal conditions but may undergo hydrolysis in the presence of strong acids or bases. The compound can participate in various chemical reactions, including esterification and transesterification, and may serve as a precursor in organic synthesis. Its unique properties make it valuable in the production of perfumes, flavoring agents, and potentially in pharmaceutical applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₁₃H₁₆O₃

InChI: InChI=1/C13H16O3/c1-3-11(13(15)16-4-2)12(14)10-8-6-5-7-9-10/h5-9,11H,3-4H2,1-2H3

SMILES: CCC(C(=O)c1ccccc1)C(=O)OCC

Ethyl 2-benzoylbutanoate

CAS: 24346-56-3

Formula: C₁₃H₁₆O₃

Purity: 98%

Molecular weight: 220.2643

Ref: IN-DA01A38T

Ethyl 2-benzoylbutanoate

CAS: 24346-56-3

Ethyl 2-benzoylbutanoate

Purity: 98%

Molecular weight: 220.26g/mol

Ref: 54-OR78381

Ethyl 2-benzoylbutanoate

CAS: 24346-56-3

Purity: 98%

Molecular weight: 220.2680054

Ref: 10-F646797

Ethyl 2-benzoylbutanoate

CAS: 24346-56-3

Versatile small molecule scaffold

Formula: C₁₃H₁₆O₃

Purity: Min. 95%

Molecular weight: 220.26 g/mol

Ref: 3D-ZAA34656