CymitQuimica logo

CAS 243462-39-7

:

N-(2-methoxybenzyl)prop-2-en-1-amine

Description:
N-(2-methoxybenzyl)prop-2-en-1-amine, identified by its CAS number 243462-39-7, is an organic compound characterized by its alkenyl amine structure. This compound features a prop-2-en-1-amine backbone, which includes a double bond between the second and third carbon atoms, contributing to its reactivity and potential applications in organic synthesis. The presence of the 2-methoxybenzyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The methoxy group can also participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. As with many organic compounds, its solubility, stability, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, N-(2-methoxybenzyl)prop-2-en-1-amine represents a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c1-3-8-12-9-10-6-4-5-7-11(10)13-2/h3-7,12H,1,8-9H2,2H3
SMILES:C=CCNCc1ccccc1OC
Synonyms:
  • benzenemethanamine, 2-methoxy-N-2-propen-1-yl-
Found 1 products.