CymitQuimica logo

CAS 243468-48-6

:

2,2'-[methanediylbis(dimethylsilanediyl)]dipyridine

Description:
2,2'-[Methanediylbis(dimethylsilanediyl)]dipyridine, with the CAS number 243468-48-6, is an organosilicon compound characterized by its unique structure that incorporates both pyridine rings and silane groups. This compound features two dimethylsilanediyl units linked by a methylene bridge, which contributes to its distinctive properties. The presence of pyridine rings imparts basicity and potential coordination chemistry, making it useful in various applications, including catalysis and materials science. The dimethylsilanediyl groups enhance the compound's stability and solubility in organic solvents, while also providing potential for further functionalization. Additionally, the compound may exhibit interesting electronic properties due to the conjugation between the pyridine rings and the silane moieties. Overall, 2,2'-[methanediylbis(dimethylsilanediyl)]dipyridine is a versatile compound with potential applications in organic synthesis, coordination chemistry, and the development of novel materials.
Formula:C15H22N2Si2
InChI:InChI=1/C15H22N2Si2/c1-18(2,14-9-5-7-11-16-14)13-19(3,4)15-10-6-8-12-17-15/h5-12H,13H2,1-4H3
SMILES:C[Si](C)(C[Si](C)(C)c1ccccn1)c1ccccn1
Synonyms:
  • 2,2'-[Methylenebis(dimethylsilanediyl)]dipyridine
  • Pyridine, 2,2'-[Methylenebis(Dimethylsilylene)]Bis-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.