CAS 243469-59-2
:2,5-Anhydro-1-azido-1-deoxy-D-glucitol
Description:
2,5-Anhydro-1-azido-1-deoxy-D-glucitol, with the CAS number 243469-59-2, is a chemical compound that belongs to the class of azido sugars. It is characterized by the presence of an azido group (-N3) attached to a sugar backbone, specifically a derivative of D-glucitol. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and methanol. The azido group imparts unique reactivity, making it useful in various chemical synthesis applications, particularly in the field of bioconjugation and click chemistry. Its structure features an anhydro configuration, which contributes to its stability and reactivity profile. The compound is of interest in medicinal chemistry and carbohydrate chemistry due to its potential applications in drug development and as a building block for more complex molecules. Safety precautions should be observed when handling this compound, as azido compounds can be sensitive and potentially hazardous.
Formula:C6H12N3O4
InChI:InChI=1/C6H11N3O4/c7-9-8-1-3-5(11)6(12)4(2-10)13-3/h3-6,10-12H,1-2H2/t3-,4+,5+,6+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2,5-Anhydro-1-azido-1-deoxy-D-glucitol
CAS:<p>2,5-Anhydro-1-azido-1-deoxy-D-glucitol is a white to off-white crystalline powder with a molecular weight of 416.2 g/mol and an empirical formula of C6H14O7. The chemical structure is O-(2,5-anhydro-D-glucitol)N3. 2,5-Anhydro-1-azido-1-deoxy--D--glucitol can be modified with various functional groups to create different derivatives for specific applications. It is soluble in water, methanol and ethanol but not in ether or acetone. It also has the ability to form stable complexes with many metal ions due to its high charge density.<br>2,5--Anhydro--1--azido--1--deoxy--D--glucitol is used as a sugar donor when making glycosides by glycosylation reactions. It can</p>Formula:C6H11N3O4Purity:Min. 95%Molecular weight:189.17 g/mol
