CAS 24347-58-8: (2R,3R)-(-)-2,3-Butanediol
Description:(2R,3R)-(-)-2,3-Butanediol, with the CAS number 24347-58-8, is a chiral organic compound that belongs to the class of diols, specifically a vicinal diol due to the presence of two hydroxyl (-OH) groups on adjacent carbon atoms. This compound is characterized by its stereochemistry, which is defined by the specific arrangement of its substituents around the chiral centers at the second and third carbon atoms. As a colorless, viscous liquid, it is soluble in water and exhibits a sweet taste. (2R,3R)-(-)-2,3-Butanediol is often used in various applications, including as a solvent, in the synthesis of pharmaceuticals, and as a building block in organic chemistry. Its enantiomeric form, (2S,3S)-(+)-2,3-butanediol, has different properties and applications, highlighting the importance of chirality in organic compounds. Additionally, this compound can participate in various chemical reactions, including oxidation and esterification, making it a versatile intermediate in organic synthesis.
Formula:C4H10O2
InChI:InChI=1S/C4H10O2/c1-3(5)4(2)6/h3-6H,1-2H3/t3-,4-/m1/s1
InChI key:InChIKey=OWBTYPJTUOEWEK-QWWZWVQMSA-N
SMILES:OC(C)C(O)C
- Synonyms:
- (-)-(2R,3R)-Butanediol
- (-)-2,3-Butanediol
- (2R,3R)-butane-2,3-diol
- (3R)-butane-2,3-diol
- (R,R)-(-)-2,3-Butanediol
- 2,3-Butanediol, (2R,3R)-
- 2,3-Butanediol, [R-(R*,R*)]-
- <span class="text-smallcaps">D</span>-(-)-2,3-Butanediol
- D(-)-2,3-Butanediol
- D-2,3-Butylene Glycol
- See more synonyms
- levo-2,3-Butanediol
