CAS 24358-29-0

2-Chloro-5-[(3,5-dimethyl-1-piperidinyl)sulfonyl]benzoic acid

Description:

2-Chloro-5-[(3,5-dimethyl-1-piperidinyl)sulfonyl]benzoic acid is a chemical compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a chlorine atom and a sulfonamide group. The presence of the chloro substituent at the 2-position and the sulfonyl group attached to a piperidine ring at the 5-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. The sulfonamide group can enhance the compound's interaction with biological targets, while the piperidine ring may influence its pharmacokinetic properties. As with many chemical substances, safety and handling precautions should be observed, as it may pose risks such as irritation or toxicity. Overall, 2-Chloro-5-[(3,5-dimethyl-1-piperidinyl)sulfonyl]benzoic acid represents a significant compound in medicinal chemistry.

Formula: C₁₄H₁₈ClNO₄S

InChI: InChI=1S/C14H18ClNO4S/c1-9-5-10(2)8-16(7-9)21(19,20)11-3-4-13(15)12(6-11)14(17)18/h3-4,6,9-10H,5,7-8H2,1-2H3,(H,17,18)

InChI key: InChIKey=IFXSWTIWFGIXQO-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C1=CC(C(O)=O)=C(Cl)C=C1)N2CC(C)CC(C)C2

Synonyms:

• 2-Chloro-5-[(3,5-dimethyl-1-piperidinyl)sulfonyl]benzoic acid
• Benzoic acid, 2-chloro-5-[(3,5-dimethylpiperidino)sulfonyl]-
• Benzoic acid, 2-chloro-5-[(3,5-dimethyl-1-piperidinyl)sulfonyl]-
• 2-Chloro-5-(3,5-dimethylpiperidinosulphonyl)benzoic acid
• 2-Chloro-5-(3,5-dimethylpiperidinosulfonyl)benzoic acid

2-Chloro-5-[(3,5-dimethylpiperidin-1-yl)sulfonyl]benzoic acid

CAS: 24358-29-0

2-Chloro-5-[(3,5-dimethylpiperidin-1-yl)sulfonyl]benzoic acid is a versatile compound with multiple applications. It is commonly used as a fatty acid plasticizer in various industries. Additionally, it has been found to have potential anticoagulant properties and can inhibit the activity of potassium channels. This compound has also shown promise in research for its ability to activate ferroelectric properties in materials such as cellulose. Furthermore, it is an important component in the synthesis of dabigatran etexilate mesylate, an anticoagulant medication. With its wide range of uses and potential applications, 2-Chloro-5-[(3,5-dimethylpiperidin-1-yl)sulfonyl]benzoic acid is a valuable compound for various industries and research purposes.

Formula: C₁₄H₁₈ClNO₄S

Purity: Min. 95%

Molecular weight: 331.8 g/mol

Ref: 3D-ZAA35829