CymitQuimica logo

CAS 24358-35-8

:

3-Ethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]morpholine

Description:
3-Ethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]morpholine, with the CAS number 24358-35-8, is an organic compound characterized by its morpholine structure, which includes a morpholine ring substituted with an ethyl group and a vinyl group linked to a trimethoxyphenyl moiety. This compound typically exhibits properties associated with both morpholines and aromatic compounds, such as moderate solubility in organic solvents and potential biological activity due to its complex structure. The presence of multiple methoxy groups on the phenyl ring can influence its electronic properties, potentially enhancing its reactivity and interaction with biological targets. Additionally, the vinyl group may participate in various chemical reactions, including polymerization or cross-linking. The compound's unique structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific biological activities or industrial uses would require further investigation. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding its stability and reactivity under different conditions.
Formula:C17H25NO4
InChI:InChI=1S/C17H25NO4/c1-5-14-12-22-9-8-18(14)7-6-13-10-15(19-2)17(21-4)16(11-13)20-3/h6-7,10-11,14H,5,8-9,12H2,1-4H3
InChI key:InChIKey=LWPRHXHXESUDGL-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=C(C=CN2C(CC)COCC2)C=C1OC
Synonyms:
  • Morpholine, 3-ethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]-
  • Morpholine, 3-ethyl-4-(3,4,5-trimethoxystyryl)-
  • 3-Ethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.