CymitQuimica logo

CAS 24365-46-6

:

L-Leucinamide, N-(1-oxopropyl)-L-leucyl-N-[4-[(aminoiminomethyl)amino]-1-formylbutyl]-

Description:
L-Leucinamide, N-(1-oxopropyl)-L-leucyl-N-[4-[(aminoiminomethyl)amino]-1-formylbutyl]- is a complex organic compound characterized by its specific amino acid structure and functional groups. It contains the amino acid leucine, which is essential for protein synthesis and plays a crucial role in muscle metabolism. The presence of an amide functional group indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. The compound also features a propyl ketone moiety, which may contribute to its biological activity. Its structure suggests potential applications in pharmaceuticals, particularly in the development of peptide-based drugs or as a biochemical probe. The CAS number 24365-46-6 uniquely identifies this compound in chemical databases, facilitating research and regulatory compliance. Overall, the characteristics of this substance highlight its potential significance in medicinal chemistry and biochemistry, although specific biological activities and properties would require further investigation through empirical studies.
Formula:C21H40N6O4
InChI:InChI=1S/C21H40N6O4/c1-6-18(29)26-16(10-13(2)3)20(31)27-17(11-14(4)5)19(30)25-15(12-28)8-7-9-24-21(22)23/h12-17H,6-11H2,1-5H3,(H,25,30)(H,26,29)(H,27,31)(H4,22,23,24)/t15?,16-,17-/m0/s1
InChI key:InChIKey=BFUKWVVFVGUARP-BSOSBYQFSA-N
SMILES:[C@@H](NC([C@@H](NC(CC)=O)CC(C)C)=O)(C(NC(CCCNC(=N)N)C=O)=O)CC(C)C
Synonyms:
  • L-Leucinamide, N-(1-oxopropyl)-L-leucyl-N-[4-[(aminoiminomethyl)amino]-1-formylbutyl]-
  • Leupeptin Pr-LL
  • Propionyl-L-leucyl-L-leucylargininal
  • Valeramide, N-(1-formyl-4-guanidinobutyl)-4-methyl-2-(4-methyl-2-propionamidovaleramido)-, stereoisomer
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.