CAS 24365-65-9
:3,4-dihydro-3-methyl-2(1H)-quinazolinone
Description:
3,4-Dihydro-3-methyl-2(1H)-quinazolinone, with the CAS number 24365-65-9, is a heterocyclic organic compound characterized by its quinazolinone structure, which features a fused bicyclic system containing both a benzene and a pyrimidine ring. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in pharmaceutical research. The presence of the methyl group at the 3-position and the dihydro group contributes to its unique chemical reactivity and stability. Additionally, the compound may participate in various chemical reactions, such as nucleophilic substitutions and cyclization processes, due to the presence of functional groups within its structure. Its synthesis often involves multi-step organic reactions, and it can serve as a precursor for the development of more complex molecules in medicinal chemistry. Overall, 3,4-dihydro-3-methyl-2(1H)-quinazolinone is a significant compound in the field of organic and medicinal chemistry.
Formula:C9H10N2O
InChI:InChI=1/C9H10N2O/c1-11-6-7-4-2-3-5-8(7)10-9(11)12/h2-5H,6H2,1H3,(H,10,12)
SMILES:CN1Cc2ccccc2N=C1O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3,4-DIHYDRO-3-METHYL-2(1H)-QUINAZOLINONE
CAS:Formula:C9H10N2OPurity:96%Color and Shape:SolidMolecular weight:162.18853-methyl-1,2,3,4-tetrahydroquinazolin-2-one
CAS:3-methyl-1,2,3,4-tetrahydroquinazolin-2-onePurity:≥95%Molecular weight:162.19g/mol3-Methyl-1,2,3,4-tetrahydroquinazolin-2-one
CAS:3-Methyl-1,2,3,4-tetrahydroquinazolin-2-onePurity:95%Molecular weight:162.19g/mol3-methyl-1,2,3,4-tetrahydroquinazolin-2-one
CAS:3-methyl-1,2,3,4-tetrahydroquinazolin-2-one is a inhibitor of BRD4 .Formula:C9H10N2OPurity:99.3% - 99.64%Color and Shape:SolidMolecular weight:162.19Ref: TM-T50006
2mg37.00€5mg52.00€10mg78.00€25mg119.00€50mg172.00€100mg259.00€500mg642.00€1mL*10mM (DMSO)56.00€3-Methyl-3,4-dihydroquinazolin-2(1H)-one
CAS:Formula:C9H10N2OPurity:95.0%Color and Shape:SolidMolecular weight:162.1923,4-Dihydro-3-methyl-2(1H)-quinazolinone
CAS:3,4-Dihydro-3-methyl-2(1H)-quinazolinone is an inhibitor of the enzyme carbonic anhydrase. It has been shown to have inhibitory properties against dopamine, which is a neurotransmitter in the brain that plays a role in motor control and cognition. 3,4-Dihydro-3-methyl-2(1H)-quinazolinone has also been shown to be effective in inhibiting chloride yields. This drug has been shown to have pharmacokinetic properties that make it suitable for oral administration. The molecule itself is stable and can be stored at room temperature without decomposition. It can be synthesized in a polymeric matrix or as a free molecule and its stability allows for convenient production at low cost.Formula:C9H10N2OPurity:Min. 95%Color and Shape:PowderMolecular weight:162.19 g/mol




