CAS 243666-12-8

2,3,4-Trifluorophenylacetic acid

Description:

2,3,4-Trifluorophenylacetic acid is an aromatic carboxylic acid characterized by the presence of a trifluoromethyl group on the phenyl ring. This compound features a phenyl group substituted with three fluorine atoms at the 2, 3, and 4 positions, which significantly influences its chemical properties, including increased acidity and potential reactivity. The presence of the carboxylic acid functional group (-COOH) contributes to its acidic nature, allowing it to participate in various chemical reactions, such as esterification and amidation. The trifluoromethyl substituents enhance the compound's lipophilicity and may affect its biological activity, making it of interest in pharmaceutical research. Additionally, the fluorine atoms can impart unique electronic properties, potentially influencing the compound's interactions with biological targets. 2,3,4-Trifluorophenylacetic acid is typically synthesized through specific fluorination and acylation reactions, and its applications may include use in agrochemicals, pharmaceuticals, or as a building block in organic synthesis. Safety and handling precautions should be observed due to the presence of fluorine, which can pose health risks.

Formula: C₈H₅F₃O₂

InChI: InChI=1/C8H5F3O2/c9-5-2-1-4(3-6(12)13)7(10)8(5)11/h1-2H,3H2,(H,12,13)

SMILES: c1cc(c(c(c1CC(=O)O)F)F)F

Synonyms:

• (2,3,4-Trifluorophenyl)acetic acid
• 2,3,4-Trifluorobenzeneacetic acid
• Qv1R Bf Cf Df

2-(2,3,4-Trifluorophenyl)acetic acid

CAS: 243666-12-8

Formula: C₈H₅F₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.1193

Ref: IN-DA003FE7

2,3,4-Trifluorophenylacetic acid

CAS: 243666-12-8

2,3,4-Trifluorophenylacetic acid

Formula: C₈H₅F₃O₂

Purity: 97%

Color and Shape: White Solid

Molecular weight: 190.12g/mol

Ref: 54-PC7818C

2,3,4-Trifluorophenylacetic acid

CAS: 243666-12-8

Formula: C₈H₅F₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.121

Ref: 10-F007690