CAS 2437-72-1
:2,3,4-Trimethylquinoline
Description:
2,3,4-Trimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that consists of a benzene ring fused to a pyridine ring. Its molecular formula is C12H13N, indicating the presence of 12 carbon atoms, 13 hydrogen atoms, and one nitrogen atom. This compound is typically a yellowish liquid or solid, depending on the temperature and purity. It exhibits a distinct aromatic odor and is soluble in organic solvents. 2,3,4-Trimethylquinoline is known for its potential applications in the synthesis of various chemical intermediates and as a building block in organic chemistry. Additionally, it may possess biological activity, making it of interest in pharmaceutical research. The compound's properties, such as boiling point, melting point, and reactivity, can vary based on its specific isomeric form and the conditions under which it is handled. As with many nitrogen-containing heterocycles, it may also participate in various chemical reactions, including electrophilic substitutions and oxidation processes.
Formula:C12H13N
InChI:InChI=1S/C12H13N/c1-8-9(2)11-6-4-5-7-12(11)13-10(8)3/h4-7H,1-3H3
InChI key:InChIKey=VBCFHWSPNHEYGE-UHFFFAOYSA-N
SMILES:CC=1C2=C(N=C(C)C1C)C=CC=C2
Synonyms:- Quinoline, 2,3,4-Trimethyl-
- Trimethylquinoline
- 2,3,4-Trimethylquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4-Trimethylquinoline
CAS:2,3,4-Trimethylquinoline is a fluorescent probe that binds to DNA and is used to detect genotoxic effects. It has shown to inhibit the activities of enzymes such as superoxide dismutase, catalase, and glutathione reductase in rat liver microsomes. 2,3,4-Trimethylquinoline can be used for the treatment of autoimmune diseases by inhibiting the production of antibodies against self-antigens. This drug has been shown to have anti-inflammatory properties as well as cytotoxic effects on benign and malignant cells. 2,3,4-Trimethylquinoline induces cell death by interfering with the mitochondrial electron transport chain and generating reactive oxygen species. It also causes apoptosis in liver cells through caspase activation.Formula:C12H13NPurity:Min. 95%Color and Shape:PowderMolecular weight:171.24 g/mol

