CAS 24370-78-3
:6-Hydroxy-1H-indole-3-carboxylic acid
Description:
6-Hydroxy-1H-indole-3-carboxylic acid, with the CAS number 24370-78-3, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a hydroxyl group (-OH) at the 6-position and a carboxylic acid group (-COOH) at the 3-position of the indole ring, contributing to its acidic properties. It is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the presence of the hydroxyl and carboxylic acid functional groups. The compound is of interest in various fields, including medicinal chemistry and biochemistry, due to its potential biological activities, including antioxidant and anti-inflammatory properties. Its structural features allow for various chemical modifications, making it a versatile building block in organic synthesis. As with many indole derivatives, it may also exhibit fluorescence, which can be useful in analytical applications.
Formula:C9H7NO3
InChI:InChI=1S/C9H7NO3/c11-5-1-2-6-7(9(12)13)4-10-8(6)3-5/h1-4,10-11H,(H,12,13)
InChI key:InChIKey=NYORHELBFKLYBG-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=CC(O)=CC2
Synonyms:- Indole-3-carboxylic acid, 6-hydroxy-
- 6-Hydroxyindole-3-carboxylic acid
- 6-Hydroxy-1H-indole-3-carboxylic acid
- 1H-Indole-3-carboxylic acid, 6-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
6-Hydroxy-1H-indole-3-carboxylic acid
CAS:Formula:C9H7NO3Color and Shape:SolidMolecular weight:177.15686-Hydroxy-1H-indole-3-carboxylic acid
CAS:Controlled ProductApplications 6-Hydroxy-1H-indole-3-carboxylic acid (cas# 24370-78-3) is a useful research chemical.
Formula:C9H7NO3Color and Shape:NeatMolecular weight:177.16

