CAS 24372-46-1

5-(dimethylamino)thiophene-2-carbaldehyde

Description:

5-(Dimethylamino)thiophene-2-carbaldehyde is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a dimethylamino group enhances its electron-donating properties, making it more reactive in various chemical reactions. The aldehyde functional group (-CHO) at the 2-position of the thiophene ring contributes to its reactivity, particularly in condensation reactions and as a potential building block in organic synthesis. This compound is typically used in the synthesis of more complex organic molecules, including dyes and pharmaceuticals, due to its ability to participate in electrophilic aromatic substitution reactions. Additionally, its unique structure allows for potential applications in materials science, particularly in the development of organic semiconductors. The compound is generally handled with care, as it may exhibit toxicity and should be stored under appropriate conditions to maintain its stability.

Formula: C₇H₉NOS

InChI: InChI=1/C7H9NOS/c1-8(2)7-4-3-6(5-9)10-7/h3-5H,1-2H3

SMILES: CN(C)c1ccc(C=O)s1

Synonyms:

• 2-Thiophenecarboxaldehyde, 5-(dimethylamino)-
• 5-dimethylamino-thiophene-2-carbaldehyde

5-(Dimethylamino)thiophene-2-carbaldehyde

CAS: 24372-46-1

Formula: C₇H₉NOS

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.2175

Ref: IN-DA007NMV

5-Dimethylamino-thiophene-2-carbaldehyde

CAS: 24372-46-1

5-Dimethylamino-thiophene-2-carbaldehyde

Purity: 97%

Molecular weight: 155.22g/mol

Ref: 54-OR322758

5-Dimethylamino-thiophene-2-carbaldehyde

CAS: 24372-46-1

Formula: C₇H₉NOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 155.22

Ref: 10-F041913

5-Dimethylamino-thiophene-2-carbaldehyde

Controlled Product

CAS: 24372-46-1

Applications 5-Dimethylamino-thiophene-2-carbaldehyde

Formula: C₇H₉NOS

Color and Shape: Neat

Molecular weight: 155.22

Ref: TR-D462490