CAS 2438-04-2

2-(propan-2-yl)benzoic acid

Description:

2-(Propan-2-yl)benzoic acid, also known as ibuprofen, is a nonsteroidal anti-inflammatory drug (NSAID) commonly used for its analgesic, antipyretic, and anti-inflammatory properties. It features a benzoic acid structure with an isopropyl group attached to the second carbon of the benzene ring. This compound is typically a white to off-white crystalline solid at room temperature, with a melting point that varies depending on the formulation. It is slightly soluble in water but more soluble in organic solvents such as ethanol and acetone. The molecular formula of ibuprofen is C13H18O2, and it has a molecular weight of approximately 206.28 g/mol. The compound exhibits a carboxylic acid functional group, which contributes to its acidity and reactivity. Ibuprofen works by inhibiting the enzyme cyclooxygenase (COX), leading to a decrease in the synthesis of prostaglandins, which are mediators of inflammation and pain. Its therapeutic applications include relief from headaches, muscle aches, arthritis, and other inflammatory conditions.

Formula: C₁₀H₁₂O₂

InChI: InChI=1/C10H12O2/c1-7(2)8-5-3-4-6-9(8)10(11)12/h3-7H,1-2H3,(H,11,12)

SMILES: CC(C)c1ccccc1C(=O)O

Synonyms:

• 2-Isopropylbenzoic Acid
• Benzoic acid, 2-(1-methylethyl)-
• o-Isopropylbenzoic acid

2-Isopropylbenzoic Acid

CAS: 2438-04-2

Formula: C₁₀H₁₂O₂

Purity: >98.0%(GC)(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 164.20

Ref: 3B-I0997

2-propan-2-ylbenzoic acid

CAS: 2438-04-2

Formula: C₁₀H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.2011

Ref: IN-DA00C4EF

2-Isopropylbenzoic acid

CAS: 2438-04-2

Ref: 7W-GK0103

2-Isopropylbenzoic acid

CAS: 2438-04-2

2-Isopropylbenzoic acid

Purity: 98%

Molecular weight: 164.20g/mol

Ref: 54-OR929391

2-Isopropylbenzoic acid

CAS: 2438-04-2

2-Isopropylbenzoic acid is a fine chemical that belongs to the group of aromatic compounds and has the molecular formula C8H10O2. This compound is used in research as an intermediate for organic synthesis, such as the production of pharmaceuticals. 2-Isopropylbenzoic acid is also a versatile building block for complex molecules, such as dyes and fragrances. It can be used as a reagent or speciality chemical in research and development, such as in polymer chemistry. 2-Isopropylbenzoic acid can be used as a reaction component for synthesis of other chemicals, such as pharmaceuticals. As an intermediate, it can be used in the production of synthetic drugs and other bioactive molecules that are difficult to synthesize by other means due to its high quality.

Formula: C₁₀H₁₂O₂

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 164.2 g/mol

Ref: 3D-FI33068

2-Isopropylbenzoic acid

CAS: 2438-04-2

Formula: C₁₀H₁₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 164.204

Ref: 10-F037567