CAS 2438-53-1
:Benzenaminium, N,N,N,2-tetramethyl-5-(1-methylethyl)-4-[(1-piperidinylcarbonyl)oxy]-, chloride (1:1)
Description:
Benzenaminium, N,N,N,2-tetramethyl-5-(1-methylethyl)-4-[(1-piperidinylcarbonyl)oxy]-, chloride (1:1), with CAS number 2438-53-1, is a quaternary ammonium compound characterized by its complex structure that includes a benzene ring, a piperidine moiety, and multiple alkyl substituents. This compound typically exhibits properties associated with quaternary ammonium salts, such as being a cationic surfactant, which can enhance solubility in water and organic solvents. Its structure suggests potential applications in pharmaceuticals or as a surfactant due to its ability to interact with biological membranes. The presence of the piperidine group may impart specific biological activity, while the tetramethyl and isopropyl groups contribute to its lipophilicity. Additionally, the chloride ion serves as a counterion, influencing the compound's solubility and stability. Overall, this compound's unique characteristics make it of interest in various chemical and biological applications, although specific reactivity and stability would depend on environmental conditions and the presence of other substances.
Formula:C19H31N2O2·Cl
InChI:InChI=1S/C19H31N2O2.ClH/c1-14(2)16-13-17(21(4,5)6)15(3)12-18(16)23-19(22)20-10-8-7-9-11-20;/h12-14H,7-11H2,1-6H3;1H/q+1;/p-1
InChI key:InChIKey=OEIMUIRJKDWCPO-UHFFFAOYSA-M
SMILES:O(C(=O)N1CCCCC1)C2=C(C(C)C)C=C([N+](C)(C)C)C(C)=C2.[Cl-]
Synonyms:- Amo 1618
- Benzenaminium, N,N,N,2-tetramethyl-5-(1-methylethyl)-4-[(1-piperidinylcarbonyl)oxy]-, chloride (1:1)
- (5-Hydroxycarvacryl)trimethylammonium chloride, 1-piperidinecarboxylate
- Ammonium, (5-hydroxycarvacryl)trimethyl-, chloride, 1-piperidinecarboxylate
- Benzenaminium, N,N,N,2-tetramethyl-5-(1-methylethyl)-4-[(1-piperidinylcarbonyl)oxy]-, chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
