CAS 24386-17-2

5'-amino-2,2':3',2''-terfuran-4'-carbonitrile

Description:

5'-Amino-2,2':3',2''-terfuran-4'-carbonitrile, with the CAS number 24386-17-2, is a chemical compound that features a unique structure characterized by a furan ring system. This compound contains an amino group and a carbonitrile functional group, which contribute to its reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of the furan moiety suggests that it may exhibit interesting electronic properties and could participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. Additionally, the carbonitrile group can enhance the compound's polarity and solubility in polar solvents, making it suitable for specific synthetic pathways. The compound's structural features may also influence its biological activity, potentially making it a candidate for further research in medicinal chemistry. Overall, 5'-amino-2,2':3',2''-terfuran-4'-carbonitrile is a versatile compound with promising characteristics for various applications, warranting further investigation into its properties and potential uses.

Formula: C₁₃H₈N₂O₃

InChI: InChI=1/C13H8N2O3/c14-7-8-11(9-3-1-5-16-9)12(18-13(8)15)10-4-2-6-17-10/h1-6H,15H2

SMILES: c1cc(c2c(C#N)c(N)oc2c2ccco2)oc1

Synonyms:

• [2,2':3',2''-Terfuran]-4'-carbonitrile, 5'-amino-
• 5'-Amino-2,2':3',2''-terfuran-4'-carbonitrile

5'-Amino-2,2':3',2''-terfuran-4'-carbonitrile

CAS: 24386-17-2

5'-Amino-2,2':3',2''-terfuran-4'-carbonitrile

Purity: ≥95%

Color and Shape: Cream Powder

Molecular weight: 240.21g/mol

Ref: 54-OR01757