CymitQuimica logo

CAS 24388-23-6

:

(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene

Description:
(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)benzene, with the CAS number 24388-23-6, is an organoboron compound characterized by the presence of a dioxaborolane ring and a benzene moiety. This compound features a boron atom bonded to two oxygen atoms within a five-membered cyclic structure, which is further substituted with four methyl groups at the 4 and 5 positions, enhancing its steric bulk and solubility. The benzene ring contributes to its aromatic properties, making it a potential candidate for various applications in organic synthesis and materials science. The presence of the boron atom allows for unique reactivity, particularly in cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the compound's structure may influence its stability and reactivity, making it of interest in the development of boron-containing pharmaceuticals and agrochemicals. Overall, this compound exemplifies the versatility of organoboron chemistry in synthetic applications.
Formula:C12H17BO2
InChI:InChI=1/C12H17BO2/c1-11(2)12(3,4)15-13(14-11)10-8-6-5-7-9-10/h5-9H,1-4H3
InChI key:KKLCYBZPQDOFQK-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccccc2)O1
Synonyms:
  • Phenyl-boronic acid pinacol ester
  • 4,4,5,5-Tetramethyl-2-Phenyl-1,3,2-Dioxaborolane
  • Benzeneboronic acid, pinacol ester
  • Phenylboronic acid pinacol ester
Found 5 products.