CAS 24391-41-1

4-chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile

Description:

4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound features a chlorine atom at the 4-position and a cyano group (-C≡N) at the 5-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the cyano group enhances its ability to participate in nucleophilic reactions, making it a valuable intermediate in the synthesis of various pharmaceuticals. Additionally, the chlorine substituent can influence the compound's electronic properties and solubility, affecting its biological activity. Typically, compounds of this nature are studied for their potential as kinase inhibitors or in other therapeutic areas due to their ability to interact with biological targets. The compound's molecular structure and functional groups suggest it may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₇H₃ClN₄

InChI: InChI=1/C7H3ClN4/c8-6-5-4(1-9)2-10-7(5)12-3-11-6/h2-3H,(H,10,11,12)

SMILES: C(#N)c1c[nH]c2c1c(Cl)ncn2

Synonyms:

• 7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile, 4-chloro-

4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile

CAS: 24391-41-1

Formula: C₇H₃ClN₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 178.5785

Ref: IN-DA007NIQ

4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile

CAS: 24391-41-1

4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile

Formula: C₇H₃ClN₄

Purity: 95%

Color and Shape: light yellow solid

Molecular weight: 178.58g/mol

Ref: 54-OR317011

4-Chloro-7H-pyrrolo[2,3-d]pyrimidine-5-carbonitrile

CAS: 24391-41-1

Formula: C₇H₃ClN₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 178.58

Ref: 10-F076948