![(5S)-3,4,5-trimethyl-5,6,7,8-tetrahydronaphtho[2,3-b]furan-9-ol](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fcas-image%2Fthumb-webp%2F312149-5s-345-trimethyl-5678-tetrahydronaphtho-23-b-furan-9-ol.webp&w=3840&q=75)
CAS 24393-79-1
:(5S)-3,4,5-trimethyl-5,6,7,8-tetrahydronaphtho[2,3-b]furan-9-ol
Description:
(5S)-3,4,5-trimethyl-5,6,7,8-tetrahydronaphtho[2,3-b]furan-9-ol, with CAS number 24393-79-1, is an organic compound characterized by its complex polycyclic structure, which includes a naphthoquinone framework fused with a furan ring. This compound features multiple methyl groups, contributing to its hydrophobic nature and potentially influencing its solubility and reactivity. The presence of a hydroxyl (-OH) group indicates that it can participate in hydrogen bonding, which may enhance its solubility in polar solvents. The stereochemistry denoted by the (5S) configuration suggests specific spatial arrangements of its substituents, which can significantly affect its biological activity and interactions with other molecules. Such compounds are often of interest in medicinal chemistry and natural product synthesis due to their potential pharmacological properties. Overall, the unique structural features of this compound may lead to diverse applications in various fields, including pharmaceuticals, agrochemicals, and materials science.
Formula:C15H18O2
InChI:InChI=1/C15H18O2/c1-8-5-4-6-11-12(8)10(3)13-9(2)7-17-15(13)14(11)16/h7-8,16H,4-6H2,1-3H3/t8-/m0/s1
SMILES:C[C@H]1CCCc2c1c(C)c1c(C)coc1c2O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
