CAS 24394-09-0
:Cnicin
Description:
Cnicin is a chemical compound classified as a sesquiterpene lactone, primarily derived from plants in the Asteraceae family, particularly from the genus Cnicus, which includes the well-known artichoke thistle. It is characterized by its unique structure, which typically features a lactone ring and multiple double bonds, contributing to its biological activity. Cnicin exhibits various pharmacological properties, including anti-inflammatory, antimicrobial, and potential anticancer effects, making it of interest in medicinal chemistry and natural product research. The compound is also known for its bitter taste, which is common among sesquiterpene lactones, and it may play a role in plant defense mechanisms against herbivores and pathogens. In terms of solubility, cnicin is generally more soluble in organic solvents than in water, which is typical for many lipophilic compounds. Its CAS number, 24394-09-0, is a unique identifier that facilitates its recognition in chemical databases and literature. Overall, cnicin represents a fascinating area of study within phytochemistry and pharmacognosy.
Formula:C20H26O7
InChI:InChI=1/C20H26O7/c1-11-5-4-6-14(9-21)8-17-18(13(3)20(25)27-17)16(7-11)26-19(24)12(2)15(23)10-22/h5,8,15-18,21-23H,2-4,6-7,9-10H2,1H3/b11-5-,14-8-/t15?,16-,17+,18+/m0/s1
InChI key:InChIKey=ZTDFZLVUIVPZDU-QGNHJMHWSA-N
SMILES:O(C(C([C@H](CO)O)=C)=O)[C@@H]1[C@@]2([C@@](/C=C(\CO)/CC/C=C(\C)/C1)(OC(=O)C2=C)[H])[H]
Synonyms:- (3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl (3R)-3,4-dihydroxy-2-methylidenebutanoate
- (3aR,4S,6Z,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl 3,4-dihydroxy-2-methylidenebutanoate
- Butanoic acid, 3,4-dihydroxy-2-methylene-, (3aR,4S,6E,10Z,11aR)-2,3,3a,4,5,8,9,11a-octahydro-10-(hydroxymethyl)-6-methyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (3R)-
- Butanoic acid, 3,4-dihydroxy-2-methylene-, 2,3,3a,4,5,8,9,11a-octahydro-10-(hydroxymethyl)-6-methyl-3-methylene-2-oxocyclodeca(b)furan-4-yl ester, (3aR-(3aR*,4S*(R*),6E,10Z,11aR*))-
- Butyric acid, 3,4-dihydroxy-2-methylene-, 8-ester with 6α,8α,15-trihydroxygermacra-1(10),4,11(13)-trien-12-oic acid γ-lactone
- Cnicin
- Cnicine
- Cyclodeca[b]furan, butanoic acid deriv.
- Germacra-1(10),4,11(13)-trien-12-oic acid, 6-alpha,8-alpha,15-trihydroxy-, 12,6-lactone, 8-(3,4-dihydroxy-2-methylenebutyrate)
- Germacra-1(10),4,11(13)-trien-12-oic acid, 6α,8α,15-trihydroxy-, 12,6-lactone, 8-(3,4-dihydroxy-2-methylenebutyrate), (Z,E)-
- 2,3,3a,4,5,8,9,11a-Octahydro-10-(hydroxymethyl)-6-methyl-3-methylene-2-oxocyclodeca(b)furan-4-yl 3,4-dihydroxy-2-methylenebutyrate
- Aids104627
- CYNISIN
- (3R)-3,4-Dihydroxy-2-methylenebutyric acid (3aR,4S,6E,10Z,11aR)-2,3,3a,4,5,8,9,11a-octahydro-10-(hydroxymethyl)-6-methyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester
- Aids-104627
- 3,4-Dihydroxy-2-methylenebutanoic acid 2,3,3A,4,5,8,9,11A-octahydro-10-(hydroxymethyl)-6-methyl-3-methylene-2-oxocyclodeca[B]furan-4-yl ester
- CENTAURIN
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Cnicin
CAS:<p>Cnicin is a natural product</p>Formula:C20H26O7Purity:98%Color and Shape:SolidMolecular weight:378.42Cnicin
CAS:LactoneFormula:C20H26O7Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:378.42Cynisin
CAS:Cynisin is a botanical extract, which is derived from specific plant species known for their antimicrobial compounds. This extract functions by disrupting bacterial cell walls and interfering with microbial DNA replication, leading to the inhibition of bacterial growth and eventual cell death. The mode of action is primarily based on the presence of bioactive compounds such as flavonoids and terpenoids, which are renowned for their ability to compromise microbial integrity through oxidative stress mechanisms.Formula:C20H26O7Purity:Min. 90 Area-%Color and Shape:White PowderMolecular weight:378.42 g/mol




