CymitQuimica logo

CAS 24396-82-5

:

N~3~,10-bis(4-chlorophenyl)-N~2~-(propan-2-yl)-2,10-dihydrophenazine-2,3-diamine

Description:
The chemical substance known as N~3~,10-bis(4-chlorophenyl)-N~2~-(propan-2-yl)-2,10-dihydrophenazine-2,3-diamine, with the CAS number 24396-82-5, is a synthetic organic compound characterized by its complex structure, which includes a phenazine core substituted with two 4-chlorophenyl groups and an isopropyl group. This compound typically exhibits properties associated with phenazine derivatives, such as potential biological activity, including antimicrobial or antitumor effects, due to the presence of the phenazine moiety. Its chlorinated phenyl groups may enhance lipophilicity, influencing its solubility and interaction with biological membranes. The presence of amino groups suggests potential for hydrogen bonding and reactivity, which could be relevant in various chemical reactions or biological interactions. Additionally, the compound's stability, solubility, and reactivity can be influenced by the specific arrangement of its substituents, making it of interest in medicinal chemistry and material science. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C27H24Cl2N4
InChI:InChI=1/C27H24Cl2N4/c1-17(2)30-24-16-27-25(15-23(24)31-20-11-7-18(28)8-12-20)32-22-5-3-4-6-26(22)33(27)21-13-9-19(29)10-14-21/h3-17,24,30-31H,1-2H3
SMILES:CC(C)NC1C=c2c(C=C1Nc1ccc(cc1)Cl)nc1ccccc1n2c1ccc(cc1)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.