CymitQuimica logo

CAS 243972-26-1

:

tert-butyl [5-(tributylstannanyl)-1,3-thiazol-2-yl]carbamate

Description:
Tert-butyl [5-(tributylstannanyl)-1,3-thiazol-2-yl]carbamate is a chemical compound characterized by its unique structure, which includes a thiazole ring and a carbamate functional group. The presence of the tributylstannanyl moiety indicates that it contains a tin atom bonded to three butyl groups, which can impart specific reactivity and solubility properties. This compound is likely to exhibit moderate to high lipophilicity due to the bulky tributyl groups, making it soluble in organic solvents. The thiazole ring contributes to its potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. Additionally, the tert-butyl group enhances the stability of the carbamate, potentially influencing its reactivity and interactions in various chemical environments. Overall, this compound may be of interest in synthetic organic chemistry, particularly in the development of organotin compounds and their applications in medicinal chemistry or materials science.
Formula:C20H38N2O2SSn
InChI:InChI=1/C8H11N2O2S.3C4H9.Sn/c1-8(2,3)12-7(11)10-6-9-4-5-13-6;3*1-3-4-2;/h4H,1-3H3,(H,9,10,11);3*1,3-4H2,2H3;/rC20H38N2O2SSn/c1-7-10-13-26(14-11-8-2,15-12-9-3)17-16-21-18(25-17)22-19(23)24-20(4,5)6/h16H,7-15H2,1-6H3,(H,21,22,23)
SMILES:CCCC[Sn](CCCC)(CCCC)c1cnc(N=C(O)OC(C)(C)C)s1
Synonyms:
  • Carbamic acid, N-[5-(tributylstannyl)-2-thiazolyl]-, 1,1-dimethylethyl ester
  • tert-Butyl [5-(tributylstannyl)-1,3-thiazol-2-yl]carbamate
Found 2 products.